ChemNet > CAS > 225104-76-7 3-Chloro-2,6-difluorobenzoic acid
225104-76-7 3-Chloro-2,6-difluorobenzoic acid
| produktnavn |
3-Chloro-2,6-difluorobenzoic acid |
| Molekylær Formel |
C7H3ClF2O2 |
| Molekylvekt |
192.5473 |
| InChI |
InChI=1/C7H3ClF2O2/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2H,(H,11,12) |
| CAS-nummer |
225104-76-7 |
| Molecular Structure |
|
| Tetthet |
1.573g/cm3 |
| Kokepunkt |
264.5°C at 760 mmHg |
| Brytningsindeks |
1.534 |
| Flammepunktet |
113.8°C |
| Hazard symboler |
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
